C30H30B2F4N4O2 — CID 139203180
4-(2,2-difluoro-3-oxa-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraen-4-yl)-N,N-dimethylaniline (PubChem CID 139203180) has the molecular formula C30H30B2F4N4O2 and a molecular weight of 576.21 g/mol. Its IUPAC name is 4-(2,2-difluoro-3-oxa-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraen-4-yl)-N,N-dimethylaniline.
| Compound Name | 4-(2,2-difluoro-3-oxa-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraen-4-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 139203180 |
| Molecular Formula | C30H30B2F4N4O2 |
| Molecular Weight | 576.21 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | 4-(2,2-difluoro-3-oxa-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraen-4-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C2=Cc3cccc[n+]3[B-](F)(F)O2)cc1.CN(C)c1ccc(C2=Cc3cccc[n+]3[B-](F)(F)O2)cc1 |
| InChI | InChI=1S/2C15H15BF2N2O/c2*1-19(2)13-8-6-12(7-9-13)15-11-14-5-3-4-10-20(14)16(17,18)21-15/h2*3-11H,1-2H3 |
| InChIKey | WAMDJKMKAJAQCB-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 32.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.21 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|