C32H22B2F4N4O2 — CID 139185842
14,14-difluoro-12-phenyl-13-oxa-8-aza-1-azonia-14-boranuidatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,8,11-hexaene (PubChem CID 139185842) has the molecular formula C32H22B2F4N4O2 and a molecular weight of 592.17 g/mol. Its IUPAC name is 14,14-difluoro-12-phenyl-13-oxa-8-aza-1-azonia-14-boranuidatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,8,11-hexaene.
| Compound Name | 14,14-difluoro-12-phenyl-13-oxa-8-aza-1-azonia-14-boranuidatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,8,11-hexaene |
|---|---|
| PubChem CID | 139185842 |
| Molecular Formula | C32H22B2F4N4O2 |
| Molecular Weight | 592.17 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | 14,14-difluoro-12-phenyl-13-oxa-8-aza-1-azonia-14-boranuidatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,8,11-hexaene |
| SMILES | F[B-]1(F)OC(c2ccccc2)=Cc2cnc3ccccc3[n+]21.F[B-]1(F)OC(c2ccccc2)=Cc2cnc3ccccc3[n+]21 |
| InChI | InChI=1S/2C16H11BF2N2O/c2*18-17(19)21-13(11-20-14-8-4-5-9-15(14)21)10-16(22-17)12-6-2-1-3-7-12/h2*1-11H |
| InChIKey | QDVGYFUYKHJREY-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 52.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.17 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|