About 1H-triazolo[1,5-a]quinoxalin-10-ium hydroxide
1H-triazolo[1,5-a]quinoxalin-10-ium hydroxide (PubChem CID 70285056) has the molecular formula C9H8N4O
and a molecular weight of 188.19 g/mol. Its IUPAC name is 1H-triazolo[1,5-a]quinoxalin-10-ium hydroxide.
Molecular Properties
| Compound Name | 1H-triazolo[1,5-a]quinoxalin-10-ium hydroxide |
| PubChem CID | 70285056 |
| Molecular Formula | C9H8N4O |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 1H-triazolo[1,5-a]quinoxalin-10-ium hydroxide |
| SMILES | [OH-].c1ccc2c(c1)ncc1cn[nH][n+]12 |
| InChI | InChI=1S/C9H6N4.H2O/c1-2-4-9-8(3-1)10-5-7-6-11-12-13(7)9;/h1-6H;1H2 |
| InChIKey | CLCJKTNBZAPHTE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 75.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1H-triazolo[1,5-a]quinoxalin-10-ium hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-triazolo[1,5-a]quinoxalin-10-ium hydroxide?
The IUPAC name of 1H-triazolo[1,5-a]quinoxalin-10-ium hydroxide (CID 70285056) is 1H-triazolo[1,5-a]quinoxalin-10-ium hydroxide.
What is the SMILES notation for 1H-triazolo[1,5-a]quinoxalin-10-ium hydroxide?
The canonical SMILES for 1H-triazolo[1,5-a]quinoxalin-10-ium hydroxide is [OH-].c1ccc2c(c1)ncc1cn[nH][n+]12.
What is the InChIKey of 1H-triazolo[1,5-a]quinoxalin-10-ium hydroxide?
The InChIKey is CLCJKTNBZAPHTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N4.H2O/c1-2-4-9-8(3-1)10-5-7-6-11-12-13(7)9;/h1-6H;1H2.
What are the key properties of 1H-triazolo[1,5-a]quinoxalin-10-ium hydroxide?
1H-triazolo[1,5-a]quinoxalin-10-ium hydroxide has a molecular weight of 188.19 g/mol, XLogP of 0.52, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-triazolo[1,5-a]quinoxalin-10-ium hydroxide is sourced from PubChem (CID 70285056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).