C16H10N3O2+ — CID 56612331
2-phenylimidazo[1,5-a]quinoxalin-10-ium-1,3-dione (PubChem CID 56612331) has the molecular formula C16H10N3O2+ and a molecular weight of 276.28 g/mol. Its IUPAC name is 2-phenylimidazo[1,5-a]quinoxalin-10-ium-1,3-dione.
| Compound Name | 2-phenylimidazo[1,5-a]quinoxalin-10-ium-1,3-dione |
|---|---|
| PubChem CID | 56612331 |
| Molecular Formula | C16H10N3O2+ |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 2-phenylimidazo[1,5-a]quinoxalin-10-ium-1,3-dione |
| SMILES | O=C1c2cnc3ccccc3[n+]2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C16H10N3O2/c20-15-14-10-17-12-8-4-5-9-13(12)19(14)16(21)18(15)11-6-2-1-3-7-11/h1-10H/q+1 |
| InChIKey | JBXBNHAQJXGSFK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 54.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|