C17H12N3O3+ — CID 56620073
2-(2-methoxyphenyl)imidazo[1,5-a]quinoxalin-10-ium-1,3-dione (PubChem CID 56620073) has the molecular formula C17H12N3O3+ and a molecular weight of 306.30 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)imidazo[1,5-a]quinoxalin-10-ium-1,3-dione.
| Compound Name | 2-(2-methoxyphenyl)imidazo[1,5-a]quinoxalin-10-ium-1,3-dione |
|---|---|
| PubChem CID | 56620073 |
| Molecular Formula | C17H12N3O3+ |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 2-(2-methoxyphenyl)imidazo[1,5-a]quinoxalin-10-ium-1,3-dione |
| SMILES | COc1ccccc1N1C(=O)c2cnc3ccccc3[n+]2C1=O |
| InChI | InChI=1S/C17H12N3O3/c1-23-15-9-5-4-8-13(15)20-16(21)14-10-18-11-6-2-3-7-12(11)19(14)17(20)22/h2-10H,1H3/q+1 |
| InChIKey | GFUQEFQCWKINRN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 63.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|