C19H17N3O3+2 — CID 56622718
2-(4-ethoxyphenyl)-5-methylimidazo[1,5-a]quinoxaline-5,10-diium-1,3-dione (PubChem CID 56622718) has the molecular formula C19H17N3O3+2 and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-5-methylimidazo[1,5-a]quinoxaline-5,10-diium-1,3-dione.
| Compound Name | 2-(4-ethoxyphenyl)-5-methylimidazo[1,5-a]quinoxaline-5,10-diium-1,3-dione |
|---|---|
| PubChem CID | 56622718 |
| Molecular Formula | C19H17N3O3+2 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 2-(4-ethoxyphenyl)-5-methylimidazo[1,5-a]quinoxaline-5,10-diium-1,3-dione |
| SMILES | CCOc1ccc(N2C(=O)c3c[n+](C)c4ccccc4[n+]3C2=O)cc1 |
| InChI | InChI=1S/C19H17N3O3/c1-3-25-14-10-8-13(9-11-14)21-18(23)17-12-20(2)15-6-4-5-7-16(15)22(17)19(21)24/h4-12H,3H2,1-2H3/q+2 |
| InChIKey | AQKLAQYNQDFEGY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|