C20H19N3O3+2 — CID 123972806
2-(4-ethoxyphenyl)-7,8-dimethylimidazo[1,5-a]quinoxaline-5,10-diium-1,3-dione (PubChem CID 123972806) has the molecular formula C20H19N3O3+2 and a molecular weight of 349.39 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-7,8-dimethylimidazo[1,5-a]quinoxaline-5,10-diium-1,3-dione.
| Compound Name | 2-(4-ethoxyphenyl)-7,8-dimethylimidazo[1,5-a]quinoxaline-5,10-diium-1,3-dione |
|---|---|
| PubChem CID | 123972806 |
| Molecular Formula | C20H19N3O3+2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 2-(4-ethoxyphenyl)-7,8-dimethylimidazo[1,5-a]quinoxaline-5,10-diium-1,3-dione |
| SMILES | CCOc1ccc(N2C(=O)c3c[nH+]c4cc(C)c(C)cc4[n+]3C2=O)cc1 |
| InChI | InChI=1S/C20H18N3O3/c1-4-26-15-7-5-14(6-8-15)22-19(24)18-11-21-16-9-12(2)13(3)10-17(16)23(18)20(22)25/h5-11H,4H2,1-3H3/q+1/p+1 |
| InChIKey | SNRLSPLTDQLVRJ-UHFFFAOYSA-O |
| XLogP | 2.59 |
| TPSA | 64.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|