C25H30N2O5S — CID 23743675
N-cyclopropyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-2,3,5,6-tetramethylbenzenesulfonamide (PubChem CID 23743675) has the molecular formula C25H30N2O5S and a molecular weight of 470.59 g/mol. Its IUPAC name is N-cyclopropyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-2,3,5,6-tetramethylbenzenesulfonamide.
| Compound Name | N-cyclopropyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-2,3,5,6-tetramethylbenzenesulfonamide |
|---|---|
| PubChem CID | 23743675 |
| Molecular Formula | C25H30N2O5S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | N-cyclopropyl-N-[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl]-2,3,5,6-tetramethylbenzenesulfonamide |
| SMILES | CCOc1ccc(N2C(=O)CC(N(C3CC3)S(=O)(=O)c3c(C)c(C)cc(C)c3C)C2=O)cc1 |
| InChI | InChI=1S/C25H30N2O5S/c1-6-32-21-11-9-19(10-12-21)26-23(28)14-22(25(26)29)27(20-7-8-20)33(30,31)24-17(4)15(2)13-16(3)18(24)5/h9-13,20,22H,6-8,14H2,1-5H3 |
| InChIKey | OFNKJYNZABRVDM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|