C25H29N3O6S — CID 23743631
N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2,2-dimethoxyethyl)-2,3,5,6-tetramethylbenzenesulfonamide (PubChem CID 23743631) has the molecular formula C25H29N3O6S and a molecular weight of 499.59 g/mol. Its IUPAC name is N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2,2-dimethoxyethyl)-2,3,5,6-tetramethylbenzenesulfonamide.
| Compound Name | N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2,2-dimethoxyethyl)-2,3,5,6-tetramethylbenzenesulfonamide |
|---|---|
| PubChem CID | 23743631 |
| Molecular Formula | C25H29N3O6S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(2,2-dimethoxyethyl)-2,3,5,6-tetramethylbenzenesulfonamide |
| SMILES | COC(CN(C1CC(=O)N(c2ccc(C#N)cc2)C1=O)S(=O)(=O)c1c(C)c(C)cc(C)c1C)OC |
| InChI | InChI=1S/C25H29N3O6S/c1-15-11-16(2)18(4)24(17(15)3)35(31,32)27(14-23(33-5)34-6)21-12-22(29)28(25(21)30)20-9-7-19(13-26)8-10-20/h7-11,21,23H,12,14H2,1-6H3 |
| InChIKey | GESXPYIVYDQNKE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 117.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|