C29H29N3O4S — CID 23914932
N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-2,3,5,6-tetramethyl-N-(1-phenylethyl)benzenesulfonamide (PubChem CID 23914932) has the molecular formula C29H29N3O4S and a molecular weight of 515.64 g/mol. Its IUPAC name is N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-2,3,5,6-tetramethyl-N-(1-phenylethyl)benzenesulfonamide.
| Compound Name | N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-2,3,5,6-tetramethyl-N-(1-phenylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 23914932 |
| Molecular Formula | C29H29N3O4S |
| Molecular Weight | 515.64 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | N-[1-(4-cyanophenyl)-2,5-dioxopyrrolidin-3-yl]-2,3,5,6-tetramethyl-N-(1-phenylethyl)benzenesulfonamide |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N(C2CC(=O)N(c3ccc(C#N)cc3)C2=O)C(C)c2ccccc2)c1C |
| InChI | InChI=1S/C29H29N3O4S/c1-18-15-19(2)21(4)28(20(18)3)37(35,36)32(22(5)24-9-7-6-8-10-24)26-16-27(33)31(29(26)34)25-13-11-23(17-30)12-14-25/h6-15,22,26H,16H2,1-5H3 |
| InChIKey | CLQAWSWOJPVMNN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 98.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.64 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|