C31H30N2O4S — CID 23914883
N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-N-(1-phenylethyl)naphthalene-2-sulfonamide (PubChem CID 23914883) has the molecular formula C31H30N2O4S and a molecular weight of 526.66 g/mol. Its IUPAC name is N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-N-(1-phenylethyl)naphthalene-2-sulfonamide.
| Compound Name | N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-N-(1-phenylethyl)naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 23914883 |
| Molecular Formula | C31H30N2O4S |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | N-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]-N-(1-phenylethyl)naphthalene-2-sulfonamide |
| SMILES | CC(C)c1ccc(N2C(=O)CC(N(C(C)c3ccccc3)S(=O)(=O)c3ccc4ccccc4c3)C2=O)cc1 |
| InChI | InChI=1S/C31H30N2O4S/c1-21(2)23-13-16-27(17-14-23)32-30(34)20-29(31(32)35)33(22(3)24-9-5-4-6-10-24)38(36,37)28-18-15-25-11-7-8-12-26(25)19-28/h4-19,21-22,29H,20H2,1-3H3 |
| InChIKey | MUZMTMMGBQXVEO-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|