C30H33N3O8S2 — CID 25046236
methyl 4-[2,5-dioxo-3-[2-(4-sulfamoylphenyl)ethyl-(2,3,5,6-tetramethylphenyl)sulfonylamino]pyrrolidin-1-yl]benzoate (PubChem CID 25046236) has the molecular formula C30H33N3O8S2 and a molecular weight of 627.74 g/mol. Its IUPAC name is methyl 4-[2,5-dioxo-3-[2-(4-sulfamoylphenyl)ethyl-(2,3,5,6-tetramethylphenyl)sulfonylamino]pyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[2,5-dioxo-3-[2-(4-sulfamoylphenyl)ethyl-(2,3,5,6-tetramethylphenyl)sulfonylamino]pyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 25046236 |
| Molecular Formula | C30H33N3O8S2 |
| Molecular Weight | 627.74 g/mol |
| Exact Mass | 627.17 |
| IUPAC Name | methyl 4-[2,5-dioxo-3-[2-(4-sulfamoylphenyl)ethyl-(2,3,5,6-tetramethylphenyl)sulfonylamino]pyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)CC(N(CCc3ccc(S(N)(=O)=O)cc3)S(=O)(=O)c3c(C)c(C)cc(C)c3C)C2=O)cc1 |
| InChI | InChI=1S/C30H33N3O8S2/c1-18-16-19(2)21(4)28(20(18)3)43(39,40)32(15-14-22-6-12-25(13-7-22)42(31,37)38)26-17-27(34)33(29(26)35)24-10-8-23(9-11-24)30(36)41-5/h6-13,16,26H,14-15,17H2,1-5H3,(H2,31,37,38) |
| InChIKey | LPDDGEQZLAYXQJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 161.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.74 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|