C21H19N3O5+2 — CID 123169977
ethyl 2-(4-ethoxyphenyl)-1,3-dioxoimidazo[1,5-a]quinoxaline-5,10-diium-8-carboxylate (PubChem CID 123169977) has the molecular formula C21H19N3O5+2 and a molecular weight of 393.40 g/mol. Its IUPAC name is ethyl 2-(4-ethoxyphenyl)-1,3-dioxoimidazo[1,5-a]quinoxaline-5,10-diium-8-carboxylate.
| Compound Name | ethyl 2-(4-ethoxyphenyl)-1,3-dioxoimidazo[1,5-a]quinoxaline-5,10-diium-8-carboxylate |
|---|---|
| PubChem CID | 123169977 |
| Molecular Formula | C21H19N3O5+2 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | ethyl 2-(4-ethoxyphenyl)-1,3-dioxoimidazo[1,5-a]quinoxaline-5,10-diium-8-carboxylate |
| SMILES | CCOC(=O)c1ccc2[nH+]cc3[n+](c2c1)C(=O)N(c1ccc(OCC)cc1)C3=O |
| InChI | InChI=1S/C21H18N3O5/c1-3-28-15-8-6-14(7-9-15)23-19(25)18-12-22-16-10-5-13(20(26)29-4-2)11-17(16)24(18)21(23)27/h5-12H,3-4H2,1-2H3/q+1/p+1 |
| InChIKey | CCFHWDWCDLZHAF-UHFFFAOYSA-O |
| XLogP | 2.15 |
| TPSA | 90.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|