C16H21N3O3 — CID 20526811
(5Z)-5-(dimethylaminomethylidene)-1-(4-ethoxyphenyl)-3-ethylimidazolidine-2,4-dione (PubChem CID 20526811) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is (5Z)-5-(dimethylaminomethylidene)-1-(4-ethoxyphenyl)-3-ethylimidazolidine-2,4-dione.
| Compound Name | (5Z)-5-(dimethylaminomethylidene)-1-(4-ethoxyphenyl)-3-ethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 20526811 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (5Z)-5-(dimethylaminomethylidene)-1-(4-ethoxyphenyl)-3-ethylimidazolidine-2,4-dione |
| SMILES | CCOc1ccc(N2C(=O)N(CC)C(=O)/C2=C/N(C)C)cc1 |
| InChI | InChI=1S/C16H21N3O3/c1-5-18-15(20)14(11-17(3)4)19(16(18)21)12-7-9-13(10-8-12)22-6-2/h7-11H,5-6H2,1-4H3/b14-11- |
| InChIKey | MDPAACFPNCFEPP-KAMYIIQDSA-N |
| XLogP | 2.28 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|