C18H15N3O3 — CID 173284470
2-(4-ethoxyphenyl)-3aH-imidazo[1,5-a]quinoxaline-1,3-dione (PubChem CID 173284470) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-3aH-imidazo[1,5-a]quinoxaline-1,3-dione.
| Compound Name | 2-(4-ethoxyphenyl)-3aH-imidazo[1,5-a]quinoxaline-1,3-dione |
|---|---|
| PubChem CID | 173284470 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2-(4-ethoxyphenyl)-3aH-imidazo[1,5-a]quinoxaline-1,3-dione |
| SMILES | CCOc1ccc(N2C(=O)C3C=Nc4ccccc4N3C2=O)cc1 |
| InChI | InChI=1S/C18H15N3O3/c1-2-24-13-9-7-12(8-10-13)20-17(22)16-11-19-14-5-3-4-6-15(14)21(16)18(20)23/h3-11,16H,2H2,1H3 |
| InChIKey | UWTBHAOCEJNOMN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|