C18H14N3O4+ — CID 173284641
[4-(1,3-dioxo-3aH-imidazo[1,5-a]quinoxalin-5-ium-2-yl)phenyl] acetate (PubChem CID 173284641) has the molecular formula C18H14N3O4+ and a molecular weight of 336.33 g/mol. Its IUPAC name is [4-(1,3-dioxo-3aH-imidazo[1,5-a]quinoxalin-5-ium-2-yl)phenyl] acetate.
| Compound Name | [4-(1,3-dioxo-3aH-imidazo[1,5-a]quinoxalin-5-ium-2-yl)phenyl] acetate |
|---|---|
| PubChem CID | 173284641 |
| Molecular Formula | C18H14N3O4+ |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | [4-(1,3-dioxo-3aH-imidazo[1,5-a]quinoxalin-5-ium-2-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N2C(=O)C3C=[NH+]c4ccccc4N3C2=O)cc1 |
| InChI | InChI=1S/C18H13N3O4/c1-11(22)25-13-8-6-12(7-9-13)20-17(23)16-10-19-14-4-2-3-5-15(14)21(16)18(20)24/h2-10,16H,1H3/p+1 |
| InChIKey | FAUKYXGXWFPJDJ-UHFFFAOYSA-O |
| XLogP | 0.75 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|