C12H10N4O — CID 57148006
1-phenyl-3,4-dihydropyrimido[4,5-d]pyrimidin-2-one (PubChem CID 57148006) has the molecular formula C12H10N4O and a molecular weight of 226.24 g/mol. Its IUPAC name is 1-phenyl-3,4-dihydropyrimido[4,5-d]pyrimidin-2-one.
| Compound Name | 1-phenyl-3,4-dihydropyrimido[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 57148006 |
| Molecular Formula | C12H10N4O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 1-phenyl-3,4-dihydropyrimido[4,5-d]pyrimidin-2-one |
| SMILES | O=C1NCc2cncnc2N1c1ccccc1 |
| InChI | InChI=1S/C12H10N4O/c17-12-14-7-9-6-13-8-15-11(9)16(12)10-4-2-1-3-5-10/h1-6,8H,7H2,(H,14,17) |
| InChIKey | HMNBGLNNOFJPHR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |