About 1,1'-biphenyl;2-chloroquinoxaline
1,1'-biphenyl;2-chloroquinoxaline (PubChem CID 174991780) has the molecular formula C20H15ClN2
and a molecular weight of 318.81 g/mol. Its IUPAC name is 1,1'-biphenyl;2-chloroquinoxaline.
Molecular Properties
| Compound Name | 1,1'-biphenyl;2-chloroquinoxaline |
| PubChem CID | 174991780 |
| Molecular Formula | C20H15ClN2 |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 1,1'-biphenyl;2-chloroquinoxaline |
| SMILES | Clc1cnc2ccccc2n1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C8H5ClN2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;9-8-5-10-6-3-1-2-4-7(6)11-8/h1-10H;1-5H |
| InChIKey | MJTIFJIZVMZAIC-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,1'-biphenyl;2-chloroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;2-chloroquinoxaline?
The IUPAC name of 1,1'-biphenyl;2-chloroquinoxaline (CID 174991780) is 1,1'-biphenyl;2-chloroquinoxaline.
What is the SMILES notation for 1,1'-biphenyl;2-chloroquinoxaline?
The canonical SMILES for 1,1'-biphenyl;2-chloroquinoxaline is Clc1cnc2ccccc2n1.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;2-chloroquinoxaline?
The InChIKey is MJTIFJIZVMZAIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C8H5ClN2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;9-8-5-10-6-3-1-2-4-7(6)11-8/h1-10H;1-5H.
What are the key properties of 1,1'-biphenyl;2-chloroquinoxaline?
1,1'-biphenyl;2-chloroquinoxaline has a molecular weight of 318.81 g/mol, XLogP of 5.64, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;2-chloroquinoxaline is sourced from PubChem (CID 174991780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).