C35H25BF2O2 — CID 177492525
2,2-difluoro-4-phenyl-6-[4-(1,2,2-triphenylethenyl)phenyl]-1-oxa-3-oxonia-2-boranuidacyclohexa-3,5-diene (PubChem CID 177492525) has the molecular formula C35H25BF2O2 and a molecular weight of 526.39 g/mol. Its IUPAC name is 2,2-difluoro-4-phenyl-6-[4-(1,2,2-triphenylethenyl)phenyl]-1-oxa-3-oxonia-2-boranuidacyclohexa-3,5-diene.
| Compound Name | 2,2-difluoro-4-phenyl-6-[4-(1,2,2-triphenylethenyl)phenyl]-1-oxa-3-oxonia-2-boranuidacyclohexa-3,5-diene |
|---|---|
| PubChem CID | 177492525 |
| Molecular Formula | C35H25BF2O2 |
| Molecular Weight | 526.39 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | 2,2-difluoro-4-phenyl-6-[4-(1,2,2-triphenylethenyl)phenyl]-1-oxa-3-oxonia-2-boranuidacyclohexa-3,5-diene |
| SMILES | F[B-]1(F)OC(c2ccc(C(=C(c3ccccc3)c3ccccc3)c3ccccc3)cc2)=CC(c2ccccc2)=[O+]1 |
| InChI | InChI=1S/C35H25BF2O2/c37-36(38)39-32(26-13-5-1-6-14-26)25-33(40-36)27-21-23-31(24-22-27)35(30-19-11-4-12-20-30)34(28-15-7-2-8-16-28)29-17-9-3-10-18-29/h1-25H |
| InChIKey | ALTPHJVEZRMQMI-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.39 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|