C21H14BF2NO — CID 139177099
18,18-difluoro-16-phenyl-17-oxa-1-azonia-18-boranuidatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2,4,6,8,10,12,15-octaene (PubChem CID 139177099) has the molecular formula C21H14BF2NO and a molecular weight of 345.16 g/mol. Its IUPAC name is 18,18-difluoro-16-phenyl-17-oxa-1-azonia-18-boranuidatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2,4,6,8,10,12,15-octaene.
| Compound Name | 18,18-difluoro-16-phenyl-17-oxa-1-azonia-18-boranuidatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2,4,6,8,10,12,15-octaene |
|---|---|
| PubChem CID | 139177099 |
| Molecular Formula | C21H14BF2NO |
| Molecular Weight | 345.16 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 18,18-difluoro-16-phenyl-17-oxa-1-azonia-18-boranuidatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2,4,6,8,10,12,15-octaene |
| SMILES | F[B-]1(F)OC(c2ccccc2)=Cc2c3ccccc3c3ccccc3[n+]21 |
| InChI | InChI=1S/C21H14BF2NO/c23-22(24)25-19-13-7-6-11-17(19)16-10-4-5-12-18(16)20(25)14-21(26-22)15-8-2-1-3-9-15/h1-14H |
| InChIKey | OZFTYKDJJFVDBE-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.16 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|