C17H11F5NO+ — CID 21342591
4-methyl-3-(2,3,4,5,6-pentafluorophenyl)-6-phenyl-2H-1,3-oxazin-3-ium (PubChem CID 21342591) has the molecular formula C17H11F5NO+ and a molecular weight of 340.27 g/mol. Its IUPAC name is 4-methyl-3-(2,3,4,5,6-pentafluorophenyl)-6-phenyl-2H-1,3-oxazin-3-ium.
| Compound Name | 4-methyl-3-(2,3,4,5,6-pentafluorophenyl)-6-phenyl-2H-1,3-oxazin-3-ium |
|---|---|
| PubChem CID | 21342591 |
| Molecular Formula | C17H11F5NO+ |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 4-methyl-3-(2,3,4,5,6-pentafluorophenyl)-6-phenyl-2H-1,3-oxazin-3-ium |
| SMILES | CC1=[N+](c2c(F)c(F)c(F)c(F)c2F)COC(c2ccccc2)=C1 |
| InChI | InChI=1S/C17H11F5NO/c1-9-7-11(10-5-3-2-4-6-10)24-8-23(9)17-15(21)13(19)12(18)14(20)16(17)22/h2-7H,8H2,1H3/q+1 |
| InChIKey | YULMQZXCPMFTGA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|