C21H17N2O+ — CID 21342496
3,6-diphenyl-4-pyridin-2-yl-2H-1,3-oxazin-3-ium (PubChem CID 21342496) has the molecular formula C21H17N2O+ and a molecular weight of 313.38 g/mol. Its IUPAC name is 3,6-diphenyl-4-pyridin-2-yl-2H-1,3-oxazin-3-ium.
| Compound Name | 3,6-diphenyl-4-pyridin-2-yl-2H-1,3-oxazin-3-ium |
|---|---|
| PubChem CID | 21342496 |
| Molecular Formula | C21H17N2O+ |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 3,6-diphenyl-4-pyridin-2-yl-2H-1,3-oxazin-3-ium |
| SMILES | C1=C(c2ccccc2)OC[N+](c2ccccc2)=C1c1ccccn1 |
| InChI | InChI=1S/C21H17N2O/c1-3-9-17(10-4-1)21-15-20(19-13-7-8-14-22-19)23(16-24-21)18-11-5-2-6-12-18/h1-15H,16H2/q+1 |
| InChIKey | YILPPMMICXPGNE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 25.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|