C17H18NO+ — CID 91185375
3,3-dimethyl-5-(4-phenylphenyl)-2H-1,3-oxazol-3-ium (PubChem CID 91185375) has the molecular formula C17H18NO+ and a molecular weight of 252.34 g/mol. Its IUPAC name is 3,3-dimethyl-5-(4-phenylphenyl)-2H-1,3-oxazol-3-ium.
| Compound Name | 3,3-dimethyl-5-(4-phenylphenyl)-2H-1,3-oxazol-3-ium |
|---|---|
| PubChem CID | 91185375 |
| Molecular Formula | C17H18NO+ |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 3,3-dimethyl-5-(4-phenylphenyl)-2H-1,3-oxazol-3-ium |
| SMILES | C[N+]1(C)C=C(c2ccc(-c3ccccc3)cc2)OC1 |
| InChI | InChI=1S/C17H18NO/c1-18(2)12-17(19-13-18)16-10-8-15(9-11-16)14-6-4-3-5-7-14/h3-12H,13H2,1-2H3/q+1 |
| InChIKey | YSDRYLOSAOJOJI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|