C15H10BF3NO- — CID 177465287
2,2,5-trifluoro-4,6-diphenyl-1-oxa-3-aza-2-boranuidacyclohexa-3,5-diene (PubChem CID 177465287) has the molecular formula C15H10BF3NO- and a molecular weight of 288.06 g/mol. Its IUPAC name is 2,2,5-trifluoro-4,6-diphenyl-1-oxa-3-aza-2-boranuidacyclohexa-3,5-diene.
| Compound Name | 2,2,5-trifluoro-4,6-diphenyl-1-oxa-3-aza-2-boranuidacyclohexa-3,5-diene |
|---|---|
| PubChem CID | 177465287 |
| Molecular Formula | C15H10BF3NO- |
| Molecular Weight | 288.06 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2,2,5-trifluoro-4,6-diphenyl-1-oxa-3-aza-2-boranuidacyclohexa-3,5-diene |
| SMILES | FC1=C(c2ccccc2)O[B-](F)(F)N=C1c1ccccc1 |
| InChI | InChI=1S/C15H10BF3NO/c17-13-14(11-7-3-1-4-8-11)20-16(18,19)21-15(13)12-9-5-2-6-10-12/h1-10H/q-1 |
| InChIKey | WXXGECFFLWAQGB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.06 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|