C28H24B2F4N2O4 — CID 139203178
2,2-difluoro-4-(4-methoxyphenyl)-3-oxa-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraene (PubChem CID 139203178) has the molecular formula C28H24B2F4N2O4 and a molecular weight of 550.13 g/mol. Its IUPAC name is 2,2-difluoro-4-(4-methoxyphenyl)-3-oxa-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraene.
| Compound Name | 2,2-difluoro-4-(4-methoxyphenyl)-3-oxa-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraene |
|---|---|
| PubChem CID | 139203178 |
| Molecular Formula | C28H24B2F4N2O4 |
| Molecular Weight | 550.13 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | 2,2-difluoro-4-(4-methoxyphenyl)-3-oxa-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraene |
| SMILES | COc1ccc(C2=Cc3cccc[n+]3[B-](F)(F)O2)cc1.COc1ccc(C2=Cc3cccc[n+]3[B-](F)(F)O2)cc1 |
| InChI | InChI=1S/2C14H12BF2NO2/c2*1-19-13-7-5-11(6-8-13)14-10-12-4-2-3-9-18(12)15(16,17)20-14/h2*2-10H,1H3 |
| InChIKey | QPEIQCBQXWOTEL-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 44.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.13 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|