C16H15N3O2 — CID 20881484
3-(4-methoxyphenyl)-N-(2-methylphenyl)-1,2,4-oxadiazol-5-amine (PubChem CID 20881484) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N-(2-methylphenyl)-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-(4-methoxyphenyl)-N-(2-methylphenyl)-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 20881484 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 3-(4-methoxyphenyl)-N-(2-methylphenyl)-1,2,4-oxadiazol-5-amine |
| SMILES | COc1ccc(-c2noc(Nc3ccccc3C)n2)cc1 |
| InChI | InChI=1S/C16H15N3O2/c1-11-5-3-4-6-14(11)17-16-18-15(19-21-16)12-7-9-13(20-2)10-8-12/h3-10H,1-2H3,(H,17,18,19) |
| InChIKey | KEFFLDMFLMFIGV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |