C24H30N2 — CID 70469901
4-[[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline;toluene (PubChem CID 70469901) has the molecular formula C24H30N2 and a molecular weight of 346.52 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline;toluene.
| Compound Name | 4-[[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline;toluene |
|---|---|
| PubChem CID | 70469901 |
| Molecular Formula | C24H30N2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 4-[[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline;toluene |
| SMILES | CN(C)c1ccc(Cc2ccc(N(C)C)cc2)cc1.Cc1ccccc1 |
| InChI | InChI=1S/C17H22N2.C7H8/c1-18(2)16-9-5-14(6-10-16)13-15-7-11-17(12-8-15)19(3)4;1-7-5-3-2-4-6-7/h5-12H,13H2,1-4H3;2-6H,1H3 |
| InChIKey | RDMDEGMYWALSMX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|