C26H28IN3O3 — CID 161367279
[4-[4-[4-(dimethylamino)phenyl]-6-[(2,5-dioxopyrrolidin-1-yl)methyl]pyran-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium iodide (PubChem CID 161367279) has the molecular formula C26H28IN3O3 and a molecular weight of 557.43 g/mol. Its IUPAC name is [4-[4-[4-(dimethylamino)phenyl]-6-[(2,5-dioxopyrrolidin-1-yl)methyl]pyran-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium iodide.
| Compound Name | [4-[4-[4-(dimethylamino)phenyl]-6-[(2,5-dioxopyrrolidin-1-yl)methyl]pyran-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium iodide |
|---|---|
| PubChem CID | 161367279 |
| Molecular Formula | C26H28IN3O3 |
| Molecular Weight | 557.43 g/mol |
| Exact Mass | 557.12 |
| IUPAC Name | [4-[4-[4-(dimethylamino)phenyl]-6-[(2,5-dioxopyrrolidin-1-yl)methyl]pyran-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium iodide |
| SMILES | CN(C)c1ccc(C2=CC(=C3C=CC(=[N+](C)C)C=C3)OC(CN3C(=O)CCC3=O)=C2)cc1.[I-] |
| InChI | InChI=1S/C26H28N3O3.HI/c1-27(2)21-9-5-18(6-10-21)20-15-23(17-29-25(30)13-14-26(29)31)32-24(16-20)19-7-11-22(12-8-19)28(3)4;/h5-12,15-16H,13-14,17H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | DNTGOAILFJOMBZ-UHFFFAOYSA-M |
| XLogP | 0.30 |
| TPSA | 52.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.43 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|