C23H25ClN2O7 — CID 159070165
[4-[6-(carboxymethyl)-4-[4-(dimethylamino)phenyl]pyran-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium perchlorate (PubChem CID 159070165) has the molecular formula C23H25ClN2O7 and a molecular weight of 476.91 g/mol. Its IUPAC name is [4-[6-(carboxymethyl)-4-[4-(dimethylamino)phenyl]pyran-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium perchlorate.
| Compound Name | [4-[6-(carboxymethyl)-4-[4-(dimethylamino)phenyl]pyran-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium perchlorate |
|---|---|
| PubChem CID | 159070165 |
| Molecular Formula | C23H25ClN2O7 |
| Molecular Weight | 476.91 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | [4-[6-(carboxymethyl)-4-[4-(dimethylamino)phenyl]pyran-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium perchlorate |
| SMILES | CN(C)c1ccc(C2=CC(=C3C=CC(=[N+](C)C)C=C3)OC(CC(=O)O)=C2)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C23H24N2O3.ClHO4/c1-24(2)19-9-5-16(6-10-19)18-13-21(15-23(26)27)28-22(14-18)17-7-11-20(12-8-17)25(3)4;2-1(3,4)5/h5-14H,15H2,1-4H3;(H,2,3,4,5) |
| InChIKey | JZNVDZLQKWZAAX-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.91 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|