C31H34N2O4 — CID 154595527
2-[4-(diethylamino)phenyl]-4-[4-[ethyl-[2-(4-methoxyphenoxy)ethyl]azaniumylidene]cyclohexa-2,5-dien-1-ylidene]-3-oxocyclobuten-1-olate (PubChem CID 154595527) has the molecular formula C31H34N2O4 and a molecular weight of 498.62 g/mol. Its IUPAC name is 2-[4-(diethylamino)phenyl]-4-[4-[ethyl-[2-(4-methoxyphenoxy)ethyl]azaniumylidene]cyclohexa-2,5-dien-1-ylidene]-3-oxocyclobuten-1-olate.
| Compound Name | 2-[4-(diethylamino)phenyl]-4-[4-[ethyl-[2-(4-methoxyphenoxy)ethyl]azaniumylidene]cyclohexa-2,5-dien-1-ylidene]-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 154595527 |
| Molecular Formula | C31H34N2O4 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | 2-[4-(diethylamino)phenyl]-4-[4-[ethyl-[2-(4-methoxyphenoxy)ethyl]azaniumylidene]cyclohexa-2,5-dien-1-ylidene]-3-oxocyclobuten-1-olate |
| SMILES | CCN(CC)c1ccc(C2=C([O-])C(=C3C=CC(=[N+](CC)CCOc4ccc(OC)cc4)C=C3)C2=O)cc1 |
| InChI | InChI=1S/C31H34N2O4/c1-5-32(6-2)24-12-8-22(9-13-24)28-30(34)29(31(28)35)23-10-14-25(15-11-23)33(7-3)20-21-37-27-18-16-26(36-4)17-19-27/h8-19H,5-7,20-21H2,1-4H3 |
| InChIKey | CGPGNTMNXVKEOG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|