C44H55N5+2 — CID 59917943
[4-[4-(diethylamino)-N-[4-(diethylamino)phenyl]anilino]phenyl]-(4-diethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)-(4-ethylphenyl)azanium (PubChem CID 59917943) has the molecular formula C44H55N5+2 and a molecular weight of 653.96 g/mol. Its IUPAC name is [4-[4-(diethylamino)-N-[4-(diethylamino)phenyl]anilino]phenyl]-(4-diethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)-(4-ethylphenyl)azanium.
| Compound Name | [4-[4-(diethylamino)-N-[4-(diethylamino)phenyl]anilino]phenyl]-(4-diethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)-(4-ethylphenyl)azanium |
|---|---|
| PubChem CID | 59917943 |
| Molecular Formula | C44H55N5+2 |
| Molecular Weight | 653.96 g/mol |
| Exact Mass | 653.44 |
| IUPAC Name | [4-[4-(diethylamino)-N-[4-(diethylamino)phenyl]anilino]phenyl]-(4-diethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)-(4-ethylphenyl)azanium |
| SMILES | CCc1ccc([N+](=C2C=CC(=[N+](CC)CC)C=C2)c2ccc(N(c3ccc(N(CC)CC)cc3)c3ccc(N(CC)CC)cc3)cc2)cc1 |
| InChI | InChI=1S/C44H55N5/c1-8-35-15-17-39(18-16-35)48(40-25-19-36(20-26-40)45(9-2)10-3)43-31-33-44(34-32-43)49(41-27-21-37(22-28-41)46(11-4)12-5)42-29-23-38(24-30-42)47(13-6)14-7/h15-34H,8-14H2,1-7H3/q+2 |
| InChIKey | YPBGAWSHCSKEQT-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 15.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.96 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|