C32H31F3N5O2S+ — CID 177267640
2-[3-(azepan-1-ium-1-ylidene)-6-(azepan-1-yl)thioxanthen-9-yl]-4-azido-3,5,6-trifluorobenzoic acid (PubChem CID 177267640) has the molecular formula C32H31F3N5O2S+ and a molecular weight of 606.69 g/mol. Its IUPAC name is 2-[3-(azepan-1-ium-1-ylidene)-6-(azepan-1-yl)thioxanthen-9-yl]-4-azido-3,5,6-trifluorobenzoic acid.
| Compound Name | 2-[3-(azepan-1-ium-1-ylidene)-6-(azepan-1-yl)thioxanthen-9-yl]-4-azido-3,5,6-trifluorobenzoic acid |
|---|---|
| PubChem CID | 177267640 |
| Molecular Formula | C32H31F3N5O2S+ |
| Molecular Weight | 606.69 g/mol |
| Exact Mass | 606.21 |
| IUPAC Name | 2-[3-(azepan-1-ium-1-ylidene)-6-(azepan-1-yl)thioxanthen-9-yl]-4-azido-3,5,6-trifluorobenzoic acid |
| SMILES | [N-]=[N+]=Nc1c(F)c(F)c(C(=O)O)c(-c2c3ccc(=[N+]4CCCCCC4)cc-3sc3cc(N4CCCCCC4)ccc23)c1F |
| InChI | InChI=1S/C32H30F3N5O2S/c33-28-27(32(41)42)26(29(34)31(30(28)35)37-38-36)25-21-11-9-19(39-13-5-1-2-6-14-39)17-23(21)43-24-18-20(10-12-22(24)25)40-15-7-3-4-8-16-40/h9-12,17-18H,1-8,13-16H2/p+1 |
| InChIKey | CSMAOHCQDQLUQA-UHFFFAOYSA-O |
| XLogP | 8.46 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.69 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|