C29H24F3N7OSi — CID 177267620
3,7-bis(azetidin-1-yl)-5'-azido-2'-diazo-4',6',7'-trifluoro-5,5-dimethylspiro[benzo[b][1]benzosiline-10,3'-indene]-1'-one (PubChem CID 177267620) has the molecular formula C29H24F3N7OSi and a molecular weight of 571.64 g/mol. Its IUPAC name is 3,7-bis(azetidin-1-yl)-5'-azido-2'-diazo-4',6',7'-trifluoro-5,5-dimethylspiro[benzo[b][1]benzosiline-10,3'-indene]-1'-one.
| Compound Name | 3,7-bis(azetidin-1-yl)-5'-azido-2'-diazo-4',6',7'-trifluoro-5,5-dimethylspiro[benzo[b][1]benzosiline-10,3'-indene]-1'-one |
|---|---|
| PubChem CID | 177267620 |
| Molecular Formula | C29H24F3N7OSi |
| Molecular Weight | 571.64 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 3,7-bis(azetidin-1-yl)-5'-azido-2'-diazo-4',6',7'-trifluoro-5,5-dimethylspiro[benzo[b][1]benzosiline-10,3'-indene]-1'-one |
| SMILES | C[Si]1(C)c2cc(N3CCC3)ccc2C2(C(=[N+]=[N-])C(=O)c3c(F)c(F)c(N=[N+]=[N-])c(F)c32)c2ccc(N3CCC3)cc21 |
| InChI | InChI=1S/C29H24F3N7OSi/c1-41(2)19-13-15(38-9-3-10-38)5-7-17(19)29(18-8-6-16(14-20(18)41)39-11-4-12-39)22-21(27(40)28(29)35-33)23(30)25(32)26(24(22)31)36-37-34/h5-8,13-14H,3-4,9-12H2,1-2H3 |
| InChIKey | HZJSXIAFBCHYIP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 108.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.64 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|