C25H27N2+ — CID 10647411
dimethyl-[4-[phenyl-(4-pyrrolidin-1-ylphenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]azanium (PubChem CID 10647411) has the molecular formula C25H27N2+ and a molecular weight of 355.51 g/mol. Its IUPAC name is dimethyl-[4-[phenyl-(4-pyrrolidin-1-ylphenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]azanium.
| Compound Name | dimethyl-[4-[phenyl-(4-pyrrolidin-1-ylphenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]azanium |
|---|---|
| PubChem CID | 10647411 |
| Molecular Formula | C25H27N2+ |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.22 |
| IUPAC Name | dimethyl-[4-[phenyl-(4-pyrrolidin-1-ylphenyl)methylidene]cyclohexa-2,5-dien-1-ylidene]azanium |
| SMILES | C[N+](C)=C1C=CC(=C(c2ccccc2)c2ccc(N3CCCC3)cc2)C=C1 |
| InChI | InChI=1S/C25H27N2/c1-26(2)23-14-10-21(11-15-23)25(20-8-4-3-5-9-20)22-12-16-24(17-13-22)27-18-6-7-19-27/h3-5,8-17H,6-7,18-19H2,1-2H3/q+1 |
| InChIKey | MGGVOESZAOQKFQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|