C30H33N2O2+ — CID 134238054
1-[7-(azetidin-1-ium-1-ylidene)-10-[2-(1-hydroperoxyethyl)phenyl]-9,9-dimethylanthracen-2-yl]azetidine (PubChem CID 134238054) has the molecular formula C30H33N2O2+ and a molecular weight of 453.61 g/mol. Its IUPAC name is 1-[7-(azetidin-1-ium-1-ylidene)-10-[2-(1-hydroperoxyethyl)phenyl]-9,9-dimethylanthracen-2-yl]azetidine.
| Compound Name | 1-[7-(azetidin-1-ium-1-ylidene)-10-[2-(1-hydroperoxyethyl)phenyl]-9,9-dimethylanthracen-2-yl]azetidine |
|---|---|
| PubChem CID | 134238054 |
| Molecular Formula | C30H33N2O2+ |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | 1-[7-(azetidin-1-ium-1-ylidene)-10-[2-(1-hydroperoxyethyl)phenyl]-9,9-dimethylanthracen-2-yl]azetidine |
| SMILES | CC(OO)c1ccccc1C1=C2C=CC(=[N+]3CCC3)C=C2C(C)(C)c2cc(N3CCC3)ccc21 |
| InChI | InChI=1S/C30H32N2O2/c1-20(34-33)23-8-4-5-9-24(23)29-25-12-10-21(31-14-6-15-31)18-27(25)30(2,3)28-19-22(11-13-26(28)29)32-16-7-17-32/h4-5,8-13,18-20H,6-7,14-17H2,1-3H3/p+1 |
| InChIKey | HFCZAASSWNZKMM-UHFFFAOYSA-O |
| XLogP | 5.89 |
| TPSA | 35.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|