C35H37F3NO3SSi+ — CID 164708326
2-[3-(azetidin-1-ium-1-ylidene)-7-cyclobutyl-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-4-(3,3-dimethyl-2-oxobutyl)sulfanyl-3,5,6-trifluorobenzoic acid (PubChem CID 164708326) has the molecular formula C35H37F3NO3SSi+ and a molecular weight of 636.83 g/mol. Its IUPAC name is 2-[3-(azetidin-1-ium-1-ylidene)-7-cyclobutyl-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-4-(3,3-dimethyl-2-oxobutyl)sulfanyl-3,5,6-trifluorobenzoic acid.
| Compound Name | 2-[3-(azetidin-1-ium-1-ylidene)-7-cyclobutyl-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-4-(3,3-dimethyl-2-oxobutyl)sulfanyl-3,5,6-trifluorobenzoic acid |
|---|---|
| PubChem CID | 164708326 |
| Molecular Formula | C35H37F3NO3SSi+ |
| Molecular Weight | 636.83 g/mol |
| Exact Mass | 636.22 |
| IUPAC Name | 2-[3-(azetidin-1-ium-1-ylidene)-7-cyclobutyl-5,5-dimethylbenzo[b][1]benzosilin-10-yl]-4-(3,3-dimethyl-2-oxobutyl)sulfanyl-3,5,6-trifluorobenzoic acid |
| SMILES | CC(C)(C)C(=O)CSc1c(F)c(F)c(C(=O)O)c(C2=C3C=CC(=[N+]4CCC4)C=C3[Si](C)(C)c3cc(C4CCC4)ccc32)c1F |
| InChI | InChI=1S/C35H36F3NO3SSi/c1-35(2,3)26(40)18-43-33-31(37)28(29(34(41)42)30(36)32(33)38)27-22-12-10-20(19-8-6-9-19)16-24(22)44(4,5)25-17-21(11-13-23(25)27)39-14-7-15-39/h10-13,16-17,19H,6-9,14-15,18H2,1-5H3/p+1 |
| InChIKey | CAEVPGBORYEBNH-UHFFFAOYSA-O |
| XLogP | 7.40 |
| TPSA | 57.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.83 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|