C23H13F5O6S — CID 143508683
2-(2,7-difluoro-3,6-dihydroxy-3H-xanthen-9-yl)-3,5,6-trifluoro-4-(2-oxopropylsulfanyl)benzoic acid (PubChem CID 143508683) has the molecular formula C23H13F5O6S and a molecular weight of 512.41 g/mol. Its IUPAC name is 2-(2,7-difluoro-3,6-dihydroxy-3H-xanthen-9-yl)-3,5,6-trifluoro-4-(2-oxopropylsulfanyl)benzoic acid.
| Compound Name | 2-(2,7-difluoro-3,6-dihydroxy-3H-xanthen-9-yl)-3,5,6-trifluoro-4-(2-oxopropylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 143508683 |
| Molecular Formula | C23H13F5O6S |
| Molecular Weight | 512.41 g/mol |
| Exact Mass | 512.04 |
| IUPAC Name | 2-(2,7-difluoro-3,6-dihydroxy-3H-xanthen-9-yl)-3,5,6-trifluoro-4-(2-oxopropylsulfanyl)benzoic acid |
| SMILES | CC(=O)CSc1c(F)c(F)c(C(=O)O)c(C2=C3C=C(F)C(O)C=C3Oc3cc(O)c(F)cc32)c1F |
| InChI | InChI=1S/C23H13F5O6S/c1-7(29)6-35-22-20(27)17(18(23(32)33)19(26)21(22)28)16-8-2-10(24)12(30)4-14(8)34-15-5-13(31)11(25)3-9(15)16/h2-5,12,30-31H,6H2,1H3,(H,32,33) |
| InChIKey | YMUSXAZHPVSKFG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|