C14H8F5NO2 — CID 175845387
2-[4-fluoro-2-hydroxy-5-(2,3,4,5-tetrafluorophenyl)phenyl]acetamide (PubChem CID 175845387) has the molecular formula C14H8F5NO2 and a molecular weight of 317.21 g/mol. Its IUPAC name is 2-[4-fluoro-2-hydroxy-5-(2,3,4,5-tetrafluorophenyl)phenyl]acetamide.
| Compound Name | 2-[4-fluoro-2-hydroxy-5-(2,3,4,5-tetrafluorophenyl)phenyl]acetamide |
|---|---|
| PubChem CID | 175845387 |
| Molecular Formula | C14H8F5NO2 |
| Molecular Weight | 317.21 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 2-[4-fluoro-2-hydroxy-5-(2,3,4,5-tetrafluorophenyl)phenyl]acetamide |
| SMILES | NC(=O)Cc1cc(-c2cc(F)c(F)c(F)c2F)c(F)cc1O |
| InChI | InChI=1S/C14H8F5NO2/c15-8-4-10(21)5(2-11(20)22)1-6(8)7-3-9(16)13(18)14(19)12(7)17/h1,3-4,21H,2H2,(H2,20,22) |
| InChIKey | PHRZAZFBXQKZIC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.21 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|