C14H8F5NO3 — CID 175845406
2-[4-fluoro-2-hydroxy-5-(2,3,4,6-tetrafluoro-5-hydroxyphenyl)phenyl]acetamide (PubChem CID 175845406) has the molecular formula C14H8F5NO3 and a molecular weight of 333.21 g/mol. Its IUPAC name is 2-[4-fluoro-2-hydroxy-5-(2,3,4,6-tetrafluoro-5-hydroxyphenyl)phenyl]acetamide.
| Compound Name | 2-[4-fluoro-2-hydroxy-5-(2,3,4,6-tetrafluoro-5-hydroxyphenyl)phenyl]acetamide |
|---|---|
| PubChem CID | 175845406 |
| Molecular Formula | C14H8F5NO3 |
| Molecular Weight | 333.21 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 2-[4-fluoro-2-hydroxy-5-(2,3,4,6-tetrafluoro-5-hydroxyphenyl)phenyl]acetamide |
| SMILES | NC(=O)Cc1cc(-c2c(F)c(O)c(F)c(F)c2F)c(F)cc1O |
| InChI | InChI=1S/C14H8F5NO3/c15-6-3-7(21)4(2-8(20)22)1-5(6)9-10(16)12(18)13(19)14(23)11(9)17/h1,3,21,23H,2H2,(H2,20,22) |
| InChIKey | DUJLNHLGUYAQIB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.21 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|