C12H6F4O4 — CID 175418191
6-(2,3,4,6-tetrafluoro-5-hydroxyphenyl)benzene-1,2,4-triol (PubChem CID 175418191) has the molecular formula C12H6F4O4 and a molecular weight of 290.17 g/mol. Its IUPAC name is 6-(2,3,4,6-tetrafluoro-5-hydroxyphenyl)benzene-1,2,4-triol.
| Compound Name | 6-(2,3,4,6-tetrafluoro-5-hydroxyphenyl)benzene-1,2,4-triol |
|---|---|
| PubChem CID | 175418191 |
| Molecular Formula | C12H6F4O4 |
| Molecular Weight | 290.17 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 6-(2,3,4,6-tetrafluoro-5-hydroxyphenyl)benzene-1,2,4-triol |
| SMILES | Oc1cc(O)c(O)c(-c2c(F)c(O)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C12H6F4O4/c13-7-6(8(14)12(20)10(16)9(7)15)4-1-3(17)2-5(18)11(4)19/h1-2,17-20H |
| InChIKey | FOSOBLBRZGTGLQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.17 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|