C11H7F3N2O — CID 82575289
2-(6,7,8-trifluoroisoquinolin-1-yl)acetamide (PubChem CID 82575289) has the molecular formula C11H7F3N2O and a molecular weight of 240.18 g/mol. Its IUPAC name is 2-(6,7,8-trifluoroisoquinolin-1-yl)acetamide.
| Compound Name | 2-(6,7,8-trifluoroisoquinolin-1-yl)acetamide |
|---|---|
| PubChem CID | 82575289 |
| Molecular Formula | C11H7F3N2O |
| Molecular Weight | 240.18 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 2-(6,7,8-trifluoroisoquinolin-1-yl)acetamide |
| SMILES | NC(=O)Cc1nccc2cc(F)c(F)c(F)c12 |
| InChI | InChI=1S/C11H7F3N2O/c12-6-3-5-1-2-16-7(4-8(15)17)9(5)11(14)10(6)13/h1-3H,4H2,(H2,15,17) |
| InChIKey | BKPGWGBPIMOPAS-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|