C44H42N4O8 — CID 166026328
2-[3-[3-[[4-[carboxymethyl(methyl)amino]-3-[2-[2-(dimethylamino)phenoxy]ethoxy]phenyl]carbamoyl]azetidin-1-yl]-6-methylidenexanthen-9-yl]benzoic acid (PubChem CID 166026328) has the molecular formula C44H42N4O8 and a molecular weight of 754.84 g/mol. Its IUPAC name is 2-[3-[3-[[4-[carboxymethyl(methyl)amino]-3-[2-[2-(dimethylamino)phenoxy]ethoxy]phenyl]carbamoyl]azetidin-1-yl]-6-methylidenexanthen-9-yl]benzoic acid.
| Compound Name | 2-[3-[3-[[4-[carboxymethyl(methyl)amino]-3-[2-[2-(dimethylamino)phenoxy]ethoxy]phenyl]carbamoyl]azetidin-1-yl]-6-methylidenexanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 166026328 |
| Molecular Formula | C44H42N4O8 |
| Molecular Weight | 754.84 g/mol |
| Exact Mass | 754.30 |
| IUPAC Name | 2-[3-[3-[[4-[carboxymethyl(methyl)amino]-3-[2-[2-(dimethylamino)phenoxy]ethoxy]phenyl]carbamoyl]azetidin-1-yl]-6-methylidenexanthen-9-yl]benzoic acid |
| SMILES | C=c1ccc2c(c1)Oc1cc(N3CC(C(=O)Nc4ccc(N(C)CC(=O)O)c(OCCOc5ccccc5N(C)C)c4)C3)ccc1C=2c1ccccc1C(=O)O |
| InChI | InChI=1S/C44H42N4O8/c1-27-13-16-33-38(21-27)56-39-23-30(15-17-34(39)42(33)31-9-5-6-10-32(31)44(52)53)48-24-28(25-48)43(51)45-29-14-18-36(47(4)26-41(49)50)40(22-29)55-20-19-54-37-12-8-7-11-35(37)46(2)3/h5-18,21-23,28H,1,19-20,24-26H2,2-4H3,(H,45,51)(H,49,50)(H,52,53) |
| InChIKey | PANWPGDRSPQGCQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.84 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|