C30H32N5O7S+ — CID 58787865
[(4S)-5-carbamoyloxy-4-[[2-[[3-carboxy-4-(3-hydroxy-6-methylidenexanthen-9-yl)phenyl]carbamothioylamino]acetyl]amino]pentyl]azanium (PubChem CID 58787865) has the molecular formula C30H32N5O7S+ and a molecular weight of 606.68 g/mol. Its IUPAC name is [(4S)-5-carbamoyloxy-4-[[2-[[3-carboxy-4-(3-hydroxy-6-methylidenexanthen-9-yl)phenyl]carbamothioylamino]acetyl]amino]pentyl]azanium.
| Compound Name | [(4S)-5-carbamoyloxy-4-[[2-[[3-carboxy-4-(3-hydroxy-6-methylidenexanthen-9-yl)phenyl]carbamothioylamino]acetyl]amino]pentyl]azanium |
|---|---|
| PubChem CID | 58787865 |
| Molecular Formula | C30H32N5O7S+ |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.20 |
| IUPAC Name | [(4S)-5-carbamoyloxy-4-[[2-[[3-carboxy-4-(3-hydroxy-6-methylidenexanthen-9-yl)phenyl]carbamothioylamino]acetyl]amino]pentyl]azanium |
| SMILES | C=c1ccc2c(c1)Oc1cc(O)ccc1C=2c1ccc(NC(=S)NCC(=O)N[C@@H](CCC[NH3+])COC(N)=O)cc1C(=O)O |
| InChI | InChI=1S/C30H31N5O7S/c1-16-4-7-21-24(11-16)42-25-13-19(36)6-9-22(25)27(21)20-8-5-17(12-23(20)28(38)39)35-30(43)33-14-26(37)34-18(3-2-10-31)15-41-29(32)40/h4-9,11-13,18,36H,1-3,10,14-15,31H2,(H2,32,40)(H,34,37)(H,38,39)(H2,33,35,43)/p+1/t18-/m0/s1 |
| InChIKey | OKCGVRHOGLJYII-SFHVURJKSA-O |
| XLogP | 0.74 |
| TPSA | 199.88 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|