C44H47N3O9S — CID 158355258
5-[8-[[2-(2-acetamidoethoxy)acetyl]amino]-9-[2-(4-hydroxyphenyl)ethylamino]-9-oxo-2-sulfanylidenenonyl]-2-(3-hydroxy-6-methylidenexanthen-9-yl)benzoic acid (PubChem CID 158355258) has the molecular formula C44H47N3O9S and a molecular weight of 793.94 g/mol. Its IUPAC name is 5-[8-[[2-(2-acetamidoethoxy)acetyl]amino]-9-[2-(4-hydroxyphenyl)ethylamino]-9-oxo-2-sulfanylidenenonyl]-2-(3-hydroxy-6-methylidenexanthen-9-yl)benzoic acid.
| Compound Name | 5-[8-[[2-(2-acetamidoethoxy)acetyl]amino]-9-[2-(4-hydroxyphenyl)ethylamino]-9-oxo-2-sulfanylidenenonyl]-2-(3-hydroxy-6-methylidenexanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 158355258 |
| Molecular Formula | C44H47N3O9S |
| Molecular Weight | 793.94 g/mol |
| Exact Mass | 793.30 |
| IUPAC Name | 5-[8-[[2-(2-acetamidoethoxy)acetyl]amino]-9-[2-(4-hydroxyphenyl)ethylamino]-9-oxo-2-sulfanylidenenonyl]-2-(3-hydroxy-6-methylidenexanthen-9-yl)benzoic acid |
| SMILES | C=c1ccc2c(c1)Oc1cc(O)ccc1C=2c1ccc(CC(=S)CCCCCC(NC(=O)COCCNC(C)=O)C(=O)NCCc2ccc(O)cc2)cc1C(=O)O |
| InChI | InChI=1S/C44H47N3O9S/c1-27-8-15-35-39(22-27)56-40-25-32(50)14-17-36(40)42(35)34-16-11-30(24-37(34)44(53)54)23-33(57)6-4-3-5-7-38(47-41(51)26-55-21-20-45-28(2)48)43(52)46-19-18-29-9-12-31(49)13-10-29/h8-17,22,24-25,38,49-50H,1,3-7,18-21,23,26H2,2H3,(H,45,48)(H,46,52)(H,47,51)(H,53,54) |
| InChIKey | QANIIXVPXBBXLI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 183.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.94 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|