C28H28N2O5S — CID 170197130
2-(3-hydroxy-6-methylidenexanthen-9-yl)-5-(3-methylbutoxymethylcarbamothioylamino)benzoic acid (PubChem CID 170197130) has the molecular formula C28H28N2O5S and a molecular weight of 504.61 g/mol. Its IUPAC name is 2-(3-hydroxy-6-methylidenexanthen-9-yl)-5-(3-methylbutoxymethylcarbamothioylamino)benzoic acid.
| Compound Name | 2-(3-hydroxy-6-methylidenexanthen-9-yl)-5-(3-methylbutoxymethylcarbamothioylamino)benzoic acid |
|---|---|
| PubChem CID | 170197130 |
| Molecular Formula | C28H28N2O5S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | 2-(3-hydroxy-6-methylidenexanthen-9-yl)-5-(3-methylbutoxymethylcarbamothioylamino)benzoic acid |
| SMILES | C=c1ccc2c(c1)Oc1cc(O)ccc1C=2c1ccc(NC(=S)NCOCCC(C)C)cc1C(=O)O |
| InChI | InChI=1S/C28H28N2O5S/c1-16(2)10-11-34-15-29-28(36)30-18-5-8-20(23(13-18)27(32)33)26-21-7-4-17(3)12-24(21)35-25-14-19(31)6-9-22(25)26/h4-9,12-14,16,31H,3,10-11,15H2,1-2H3,(H,32,33)(H2,29,30,36) |
| InChIKey | ZGEUXSFRHCHYSW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|