C30H26N2O7 — CID 126598700
methyl 1-[6'-(3-methoxycarbonylazetidin-1-yl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl]azetidine-3-carboxylate (PubChem CID 126598700) has the molecular formula C30H26N2O7 and a molecular weight of 526.55 g/mol. Its IUPAC name is methyl 1-[6'-(3-methoxycarbonylazetidin-1-yl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl]azetidine-3-carboxylate.
| Compound Name | methyl 1-[6'-(3-methoxycarbonylazetidin-1-yl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl]azetidine-3-carboxylate |
|---|---|
| PubChem CID | 126598700 |
| Molecular Formula | C30H26N2O7 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | methyl 1-[6'-(3-methoxycarbonylazetidin-1-yl)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl]azetidine-3-carboxylate |
| SMILES | COC(=O)C1CN(c2ccc3c(c2)Oc2cc(N4CC(C(=O)OC)C4)ccc2C32OC(=O)c3ccccc32)C1 |
| InChI | InChI=1S/C30H26N2O7/c1-36-27(33)17-13-31(14-17)19-7-9-23-25(11-19)38-26-12-20(32-15-18(16-32)28(34)37-2)8-10-24(26)30(23)22-6-4-3-5-21(22)29(35)39-30/h3-12,17-18H,13-16H2,1-2H3 |
| InChIKey | NTSFWTBICKBFCR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|