C27H23FN2O3 — CID 135207761
3'-(3-fluoroazetidin-1-yl)-6'-(3-methylazetidin-1-yl)spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 135207761) has the molecular formula C27H23FN2O3 and a molecular weight of 442.49 g/mol. Its IUPAC name is 3'-(3-fluoroazetidin-1-yl)-6'-(3-methylazetidin-1-yl)spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 3'-(3-fluoroazetidin-1-yl)-6'-(3-methylazetidin-1-yl)spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 135207761 |
| Molecular Formula | C27H23FN2O3 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 3'-(3-fluoroazetidin-1-yl)-6'-(3-methylazetidin-1-yl)spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CC1CN(c2ccc3c(c2)Oc2cc(N4CC(F)C4)ccc2C32OC(=O)c3ccccc32)C1 |
| InChI | InChI=1S/C27H23FN2O3/c1-16-12-29(13-16)18-6-8-22-24(10-18)32-25-11-19(30-14-17(28)15-30)7-9-23(25)27(22)21-5-3-2-4-20(21)26(31)33-27/h2-11,16-17H,12-15H2,1H3 |
| InChIKey | CWXKFEPNYOZAAE-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|