C22H22N2O2Si — CID 156663147
2-(3,7-diamino-5,5-dimethyl-7H-benzo[b][1]benzosilin-10-yl)benzoic acid (PubChem CID 156663147) has the molecular formula C22H22N2O2Si and a molecular weight of 374.52 g/mol. Its IUPAC name is 2-(3,7-diamino-5,5-dimethyl-7H-benzo[b][1]benzosilin-10-yl)benzoic acid.
| Compound Name | 2-(3,7-diamino-5,5-dimethyl-7H-benzo[b][1]benzosilin-10-yl)benzoic acid |
|---|---|
| PubChem CID | 156663147 |
| Molecular Formula | C22H22N2O2Si |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-(3,7-diamino-5,5-dimethyl-7H-benzo[b][1]benzosilin-10-yl)benzoic acid |
| SMILES | C[Si]1(C)C2=CC(N)C=CC2=C(c2ccccc2C(=O)O)c2ccc(N)cc21 |
| InChI | InChI=1S/C22H22N2O2Si/c1-27(2)19-11-13(23)7-9-17(19)21(18-10-8-14(24)12-20(18)27)15-5-3-4-6-16(15)22(25)26/h3-13H,23-24H2,1-2H3,(H,25,26) |
| InChIKey | LBFSRWOYEPCONI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|