C35H26N2O4 — CID 143870807
2-[7-(4-amino-N-methylanilino)-19-hydroxy-2-oxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(22),3(12),4(9),5,7,10,13,15,17,20-decaen-13-yl]benzoic acid (PubChem CID 143870807) has the molecular formula C35H26N2O4 and a molecular weight of 538.60 g/mol. Its IUPAC name is 2-[7-(4-amino-N-methylanilino)-19-hydroxy-2-oxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(22),3(12),4(9),5,7,10,13,15,17,20-decaen-13-yl]benzoic acid.
| Compound Name | 2-[7-(4-amino-N-methylanilino)-19-hydroxy-2-oxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(22),3(12),4(9),5,7,10,13,15,17,20-decaen-13-yl]benzoic acid |
|---|---|
| PubChem CID | 143870807 |
| Molecular Formula | C35H26N2O4 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | 2-[7-(4-amino-N-methylanilino)-19-hydroxy-2-oxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(22),3(12),4(9),5,7,10,13,15,17,20-decaen-13-yl]benzoic acid |
| SMILES | CN(c1ccc(N)cc1)c1ccc2c3c(ccc2c1)C(c1ccccc1C(=O)O)=c1ccc2c(c1O3)C=CC(O)C=2 |
| InChI | InChI=1S/C35H26N2O4/c1-37(23-10-8-22(36)9-11-23)24-12-16-26-20(18-24)6-14-30-32(28-4-2-3-5-29(28)35(39)40)31-15-7-21-19-25(38)13-17-27(21)34(31)41-33(26)30/h2-19,25,38H,36H2,1H3,(H,39,40) |
| InChIKey | SIICZYYFDMPJGQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|