C22H15ClO4 — CID 143196709
2-(2-chloro-6-hydroxy-5-methyl-3-methylidenexanthen-9-yl)benzoic acid (PubChem CID 143196709) has the molecular formula C22H15ClO4 and a molecular weight of 378.81 g/mol. Its IUPAC name is 2-(2-chloro-6-hydroxy-5-methyl-3-methylidenexanthen-9-yl)benzoic acid.
| Compound Name | 2-(2-chloro-6-hydroxy-5-methyl-3-methylidenexanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 143196709 |
| Molecular Formula | C22H15ClO4 |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 2-(2-chloro-6-hydroxy-5-methyl-3-methylidenexanthen-9-yl)benzoic acid |
| SMILES | C=c1cc2c(cc1Cl)=C(c1ccccc1C(=O)O)c1ccc(O)c(C)c1O2 |
| InChI | InChI=1S/C22H15ClO4/c1-11-9-19-16(10-17(11)23)20(13-5-3-4-6-14(13)22(25)26)15-7-8-18(24)12(2)21(15)27-19/h3-10,24H,1H2,2H3,(H,25,26) |
| InChIKey | OAEZUCFGJVVVAH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |